About [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate
[triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate (PubChem CID 88707848) has the molecular formula C33H31AsO3S
and a molecular weight of 582.60 g/mol. Its IUPAC name is [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate |
| PubChem CID | 88707848 |
| Molecular Formula | C33H31AsO3S |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[As](CCc2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H31AsO3S/c1-28-22-24-33(25-23-28)38(35,36)37-34(30-16-8-3-9-17-30,31-18-10-4-11-19-31,32-20-12-5-13-21-32)27-26-29-14-6-2-7-15-29/h2-25H,26-27H2,1H3 |
| InChIKey | OXDKOEIYNCKKHV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate?
The IUPAC name of [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate (CID 88707848) is [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O[As](CCc2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate?
The InChIKey is OXDKOEIYNCKKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H31AsO3S/c1-28-22-24-33(25-23-28)38(35,36)37-34(30-16-8-3-9-17-30,31-18-10-4-11-19-31,32-20-12-5-13-21-32)27-26-29-14-6-2-7-15-29/h2-25H,26-27H2,1H3.
What are the key properties of [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate?
[triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate has a molecular weight of 582.60 g/mol, XLogP of 5.56, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [triphenyl(2-phenylethyl)-λ5-arsanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 88707848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).