C20H25NO5S — CID 145442713
(6-phenylhexoxycarbonylamino) 4-methylbenzenesulfonate (PubChem CID 145442713) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is (6-phenylhexoxycarbonylamino) 4-methylbenzenesulfonate.
| Compound Name | (6-phenylhexoxycarbonylamino) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 145442713 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (6-phenylhexoxycarbonylamino) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONC(=O)OCCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-17-12-14-19(15-13-17)27(23,24)26-21-20(22)25-16-8-3-2-5-9-18-10-6-4-7-11-18/h4,6-7,10-15H,2-3,5,8-9,16H2,1H3,(H,21,22) |
| InChIKey | WTGSXQMGAMNLSV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|