C32H36F8N4O5S — CID 157302456
N-cyclohexyl-3-[2-(2,3-difluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157302456) has the molecular formula C32H36F8N4O5S and a molecular weight of 740.71 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-(2,3-difluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-cyclohexyl-3-[2-(2,3-difluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157302456 |
| Molecular Formula | C32H36F8N4O5S |
| Molecular Weight | 740.71 g/mol |
| Exact Mass | 740.23 |
| IUPAC Name | N-cyclohexyl-3-[2-(2,3-difluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.O=C(CCNCCc1cccc(F)c1F)N(CCNCCc1ccc(O)c2[nH]c(=O)sc12)C1CCCCC1 |
| InChI | InChI=1S/C28H36F2N4O3S.C4F6O2/c29-22-8-4-5-19(25(22)30)11-14-31-16-13-24(36)34(21-6-2-1-3-7-21)18-17-32-15-12-20-9-10-23(35)26-27(20)38-28(37)33-26;5-3(6,7)1(11)2(12)4(8,9)10/h4-5,8-10,21,31-32,35H,1-3,6-7,11-18H2,(H,33,37); |
| InChIKey | BCBGDNWNOAFFMI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|