C35H41F7N4O5 — CID 157388112
N-cycloheptyl-3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157388112) has the molecular formula C35H41F7N4O5 and a molecular weight of 730.72 g/mol. Its IUPAC name is N-cycloheptyl-3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-cycloheptyl-3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157388112 |
| Molecular Formula | C35H41F7N4O5 |
| Molecular Weight | 730.72 g/mol |
| Exact Mass | 730.30 |
| IUPAC Name | N-cycloheptyl-3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.O=C(CCNCCc1cccc(F)c1)N(CCNCCc1ccc(O)c2[nH]c(=O)ccc12)C1CCCCCC1 |
| InChI | InChI=1S/C31H41FN4O3.C4F6O2/c32-25-7-5-6-23(22-25)14-17-33-19-16-30(39)36(26-8-3-1-2-4-9-26)21-20-34-18-15-24-10-12-28(37)31-27(24)11-13-29(38)35-31;5-3(6,7)1(11)2(12)4(8,9)10/h5-7,10-13,22,26,33-34,37H,1-4,8-9,14-21H2,(H,35,38); |
| InChIKey | BLRCGIRTAWXARX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|