C31H39FN2O4 — CID 160809378
N-cyclohexyl-3-[2-(3-fluorophenyl)ethoxy]-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]propanamide (PubChem CID 160809378) has the molecular formula C31H39FN2O4 and a molecular weight of 522.66 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-(3-fluorophenyl)ethoxy]-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]propanamide.
| Compound Name | N-cyclohexyl-3-[2-(3-fluorophenyl)ethoxy]-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 160809378 |
| Molecular Formula | C31H39FN2O4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | N-cyclohexyl-3-[2-(3-fluorophenyl)ethoxy]-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]propanamide |
| SMILES | O=C(CCOCCc1cccc(F)c1)N(CCCCCc1ccc(O)c2[nH]c(=O)ccc12)C1CCCCC1 |
| InChI | InChI=1S/C31H39FN2O4/c32-25-10-7-8-23(22-25)17-20-38-21-18-30(37)34(26-11-4-1-5-12-26)19-6-2-3-9-24-13-15-28(35)31-27(24)14-16-29(36)33-31/h7-8,10,13-16,22,26,35H,1-6,9,11-12,17-21H2,(H,33,36) |
| InChIKey | SECQFJLVEQURJH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|