C30H39F2N3O3S — CID 59158100
N-cycloheptyl-3-[2-(2,6-difluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide (PubChem CID 59158100) has the molecular formula C30H39F2N3O3S and a molecular weight of 559.72 g/mol. Its IUPAC name is N-cycloheptyl-3-[2-(2,6-difluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide.
| Compound Name | N-cycloheptyl-3-[2-(2,6-difluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 59158100 |
| Molecular Formula | C30H39F2N3O3S |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | N-cycloheptyl-3-[2-(2,6-difluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide |
| SMILES | O=C(CCNCCc1c(F)cccc1F)N(CCCCCc1ccc(O)c2[nH]c(=O)sc12)C1CCCCCC1 |
| InChI | InChI=1S/C30H39F2N3O3S/c31-24-12-8-13-25(32)23(24)16-18-33-19-17-27(37)35(22-10-5-1-2-6-11-22)20-7-3-4-9-21-14-15-26(36)28-29(21)39-30(38)34-28/h8,12-15,22,33,36H,1-7,9-11,16-20H2,(H,34,38) |
| InChIKey | BMMHVHLYWRQXMS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|