C30H40ClN3O4 — CID 159582960
3-[2-(3-chlorophenyl)ethylamino]-N-cyclohexyl-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide (PubChem CID 159582960) has the molecular formula C30H40ClN3O4 and a molecular weight of 542.12 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethylamino]-N-cyclohexyl-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide.
| Compound Name | 3-[2-(3-chlorophenyl)ethylamino]-N-cyclohexyl-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 159582960 |
| Molecular Formula | C30H40ClN3O4 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethylamino]-N-cyclohexyl-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide |
| SMILES | O=C1COc2c(CCCCCN(C(=O)CCNCCc3cccc(Cl)c3)C3CCCCC3)ccc(O)c2N1 |
| InChI | InChI=1S/C30H40ClN3O4/c31-24-10-7-8-22(20-24)15-17-32-18-16-28(37)34(25-11-4-1-5-12-25)19-6-2-3-9-23-13-14-26(35)29-30(23)38-21-27(36)33-29/h7-8,10,13-14,20,25,32,35H,1-6,9,11-12,15-19,21H2,(H,33,36) |
| InChIKey | MJGCJNPEXRVNBJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|