C33H38F8N4O6 — CID 161215287
N-cyclohexyl-3-[2-(2,5-difluorophenyl)ethylamino]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 161215287) has the molecular formula C33H38F8N4O6 and a molecular weight of 738.67 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-(2,5-difluorophenyl)ethylamino]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-cyclohexyl-3-[2-(2,5-difluorophenyl)ethylamino]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 161215287 |
| Molecular Formula | C33H38F8N4O6 |
| Molecular Weight | 738.67 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | N-cyclohexyl-3-[2-(2,5-difluorophenyl)ethylamino]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.O=C1COc2c(CCNCCN(C(=O)CCNCCc3cc(F)ccc3F)C3CCCCC3)ccc(O)c2N1 |
| InChI | InChI=1S/C29H38F2N4O4.C4F6O2/c30-22-7-8-24(31)21(18-22)11-14-32-15-12-27(38)35(23-4-2-1-3-5-23)17-16-33-13-10-20-6-9-25(36)28-29(20)39-19-26(37)34-28;5-3(6,7)1(11)2(12)4(8,9)10/h6-9,18,23,32-33,36H,1-5,10-17,19H2,(H,34,37); |
| InChIKey | UWTVYKSKBSDICY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|