C31H43N5O5 — CID 143914562
N-cyclohexyl-3-[2-[3-[(Z)-1,2-diaminoethenyl]phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide (PubChem CID 143914562) has the molecular formula C31H43N5O5 and a molecular weight of 565.72 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-[3-[(Z)-1,2-diaminoethenyl]phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide.
| Compound Name | N-cyclohexyl-3-[2-[3-[(Z)-1,2-diaminoethenyl]phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 143914562 |
| Molecular Formula | C31H43N5O5 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | N-cyclohexyl-3-[2-[3-[(Z)-1,2-diaminoethenyl]phenyl]ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide |
| SMILES | N/C=C(\N)c1cccc(CCOCCC(=O)N(CCNCCc2ccc(O)c3c2OCC(=O)N3)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H43N5O5/c32-20-26(33)24-6-4-5-22(19-24)12-17-40-18-13-29(39)36(25-7-2-1-3-8-25)16-15-34-14-11-23-9-10-27(37)30-31(23)41-21-28(38)35-30/h4-6,9-10,19-20,25,34,37H,1-3,7-8,11-18,21,32-33H2,(H,35,38)/b26-20- |
| InChIKey | DAYZUVMVIXARMK-QOMWVZHYSA-N |
| XLogP | 2.88 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|