C33H46N5O5+ — CID 147679980
[2-[3-[2-[3-[cyclopentyl-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]amino]-3-oxopropoxy]ethyl]phenyl]-3-iminoprop-1-enyl]-ethylazanium (PubChem CID 147679980) has the molecular formula C33H46N5O5+ and a molecular weight of 592.76 g/mol. Its IUPAC name is [2-[3-[2-[3-[cyclopentyl-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]amino]-3-oxopropoxy]ethyl]phenyl]-3-iminoprop-1-enyl]-ethylazanium.
| Compound Name | [2-[3-[2-[3-[cyclopentyl-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]amino]-3-oxopropoxy]ethyl]phenyl]-3-iminoprop-1-enyl]-ethylazanium |
|---|---|
| PubChem CID | 147679980 |
| Molecular Formula | C33H46N5O5+ |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | [2-[3-[2-[3-[cyclopentyl-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]amino]-3-oxopropoxy]ethyl]phenyl]-3-iminoprop-1-enyl]-ethylazanium |
| SMILES | [H]/N=C/C(=C[NH2+]CC)c1cccc(CCOCCC(=O)N(CCNCCc2ccc(O)c3c2OCC(=O)N3)C2CCCC2)c1 |
| InChI | InChI=1S/C33H45N5O5/c1-2-35-22-27(21-34)26-7-5-6-24(20-26)13-18-42-19-14-31(41)38(28-8-3-4-9-28)17-16-36-15-12-25-10-11-29(39)32-33(25)43-23-30(40)37-32/h5-7,10-11,20-22,28,34-36,39H,2-4,8-9,12-19,23H2,1H3,(H,37,40)/p+1/b27-22?,34-21+ |
| InChIKey | GOXWEMKXZOHEHK-SEKQWTRKSA-O |
| XLogP | 2.85 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|