C27H28FN3O2 — CID 157306453
(4S)-4-(4-fluorophenyl)-8-(4-oxo-4-quinolin-3-ylbutyl)-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 157306453) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is (4S)-4-(4-fluorophenyl)-8-(4-oxo-4-quinolin-3-ylbutyl)-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | (4S)-4-(4-fluorophenyl)-8-(4-oxo-4-quinolin-3-ylbutyl)-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 157306453 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (4S)-4-(4-fluorophenyl)-8-(4-oxo-4-quinolin-3-ylbutyl)-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C(CCCN1CCC2(CC1)C(=O)NC[C@H]2c1ccc(F)cc1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H28FN3O2/c28-22-9-7-19(8-10-22)23-18-30-26(33)27(23)11-14-31(15-12-27)13-3-6-25(32)21-16-20-4-1-2-5-24(20)29-17-21/h1-2,4-5,7-10,16-17,23H,3,6,11-15,18H2,(H,30,33)/t23-/m0/s1 |
| InChIKey | MNUREGJTHMSQJM-QHCPKHFHSA-N |
| XLogP | 4.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |