C30H25N2O8P — CID 157309157
[(1S,3R,7R)-3-[2,4-dioxo-5-(2-pyren-1-ylethynyl)pyrimidin-1-yl]-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-methylphosphinic acid (PubChem CID 157309157) has the molecular formula C30H25N2O8P and a molecular weight of 572.51 g/mol. Its IUPAC name is [(1S,3R,7R)-3-[2,4-dioxo-5-(2-pyren-1-ylethynyl)pyrimidin-1-yl]-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-methylphosphinic acid.
| Compound Name | [(1S,3R,7R)-3-[2,4-dioxo-5-(2-pyren-1-ylethynyl)pyrimidin-1-yl]-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 157309157 |
| Molecular Formula | C30H25N2O8P |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | [(1S,3R,7R)-3-[2,4-dioxo-5-(2-pyren-1-ylethynyl)pyrimidin-1-yl]-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-methylphosphinic acid |
| SMILES | COC[C@@]12COC([C@H](n3cc(C#Cc4ccc5ccc6cccc7ccc4c5c67)c(=O)[nH]c3=O)O1)[C@H]2OP(C)(=O)O |
| InChI | InChI=1S/C30H25N2O8P/c1-37-15-30-16-38-25(26(30)40-41(2,35)36)28(39-30)32-14-21(27(33)31-29(32)34)11-7-17-6-8-20-10-9-18-4-3-5-19-12-13-22(17)24(20)23(18)19/h3-6,8-10,12-14,25-26,28H,15-16H2,1-2H3,(H,35,36)(H,31,33,34)/t25?,26-,28-,30+/m1/s1 |
| InChIKey | LALSHZUFILGBPN-ABXIUDPPSA-N |
| XLogP | 3.35 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|