C14H8BBrF6N6O2 — CID 157312951
6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine;[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid (PubChem CID 157312951) has the molecular formula C14H8BBrF6N6O2 and a molecular weight of 496.96 g/mol. Its IUPAC name is 6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine;[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid.
| Compound Name | 6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine;[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid |
|---|---|
| PubChem CID | 157312951 |
| Molecular Formula | C14H8BBrF6N6O2 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine;[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]boronic acid |
| SMILES | FC(F)(F)c1nnc2ccc(Br)cn12.OB(O)c1ccc2nnc(C(F)(F)F)n2c1 |
| InChI | InChI=1S/C7H5BF3N3O2.C7H3BrF3N3/c9-7(10,11)6-13-12-5-2-1-4(8(15)16)3-14(5)6;8-4-1-2-5-12-13-6(7(9,10)11)14(5)3-4/h1-3,15-16H;1-3H |
| InChIKey | BDGFSGAWUZNMFQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|