C15H26O7S — CID 157316508
5-ethyl-3-prop-1-enoxycarbonyl-3-sulfononanoic acid (PubChem CID 157316508) has the molecular formula C15H26O7S and a molecular weight of 350.43 g/mol. Its IUPAC name is 5-ethyl-3-prop-1-enoxycarbonyl-3-sulfononanoic acid.
| Compound Name | 5-ethyl-3-prop-1-enoxycarbonyl-3-sulfononanoic acid |
|---|---|
| PubChem CID | 157316508 |
| Molecular Formula | C15H26O7S |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-ethyl-3-prop-1-enoxycarbonyl-3-sulfononanoic acid |
| SMILES | CC=COC(=O)C(CC(=O)O)(CC(CC)CCCC)S(=O)(=O)O |
| InChI | InChI=1S/C15H26O7S/c1-4-7-8-12(6-3)10-15(11-13(16)17,23(19,20)21)14(18)22-9-5-2/h5,9,12H,4,6-8,10-11H2,1-3H3,(H,16,17)(H,19,20,21) |
| InChIKey | BDQRPTSXZRXFDU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|