C28H54O7S — CID 175565201
5-ethyl-3-(2-ethylhexoxycarbonyl)-2-(2-ethylhexyl)-3-sulfononanoic acid (PubChem CID 175565201) has the molecular formula C28H54O7S and a molecular weight of 534.80 g/mol. Its IUPAC name is 5-ethyl-3-(2-ethylhexoxycarbonyl)-2-(2-ethylhexyl)-3-sulfononanoic acid.
| Compound Name | 5-ethyl-3-(2-ethylhexoxycarbonyl)-2-(2-ethylhexyl)-3-sulfononanoic acid |
|---|---|
| PubChem CID | 175565201 |
| Molecular Formula | C28H54O7S |
| Molecular Weight | 534.80 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | 5-ethyl-3-(2-ethylhexoxycarbonyl)-2-(2-ethylhexyl)-3-sulfononanoic acid |
| SMILES | CCCCC(CC)COC(=O)C(CC(CC)CCCC)(C(CC(CC)CCCC)C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C28H54O7S/c1-7-13-16-22(10-4)19-25(26(29)30)28(36(32,33)34,20-23(11-5)17-14-8-2)27(31)35-21-24(12-6)18-15-9-3/h22-25H,7-21H2,1-6H3,(H,29,30)(H,32,33,34) |
| InChIKey | OYCLJITYVFHGPW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.80 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|