C21H28N4O — CID 157316787
2-amino-6-(2-hydroxyphenyl)-4-(1-propylpiperidin-3-yl)pyridine-3-carbonitrile;methane (PubChem CID 157316787) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-amino-6-(2-hydroxyphenyl)-4-(1-propylpiperidin-3-yl)pyridine-3-carbonitrile;methane.
| Compound Name | 2-amino-6-(2-hydroxyphenyl)-4-(1-propylpiperidin-3-yl)pyridine-3-carbonitrile;methane |
|---|---|
| PubChem CID | 157316787 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-amino-6-(2-hydroxyphenyl)-4-(1-propylpiperidin-3-yl)pyridine-3-carbonitrile;methane |
| SMILES | C.CCCN1CCCC(c2cc(-c3ccccc3O)nc(N)c2C#N)C1 |
| InChI | InChI=1S/C20H24N4O.CH4/c1-2-9-24-10-5-6-14(13-24)16-11-18(23-20(22)17(16)12-21)15-7-3-4-8-19(15)25;/h3-4,7-8,11,14,25H,2,5-6,9-10,13H2,1H3,(H2,22,23);1H4 |
| InChIKey | BDRNQZNOOMHHLL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |