C20H20ClN5O2 — CID 157319144
5-[4-(4-chloro-3-methylphenoxy)-6-morpholin-4-yl-2-pyridinyl]pyrimidin-2-amine (PubChem CID 157319144) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is 5-[4-(4-chloro-3-methylphenoxy)-6-morpholin-4-yl-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | 5-[4-(4-chloro-3-methylphenoxy)-6-morpholin-4-yl-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 157319144 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 5-[4-(4-chloro-3-methylphenoxy)-6-morpholin-4-yl-2-pyridinyl]pyrimidin-2-amine |
| SMILES | Cc1cc(Oc2cc(-c3cnc(N)nc3)nc(N3CCOCC3)c2)ccc1Cl |
| InChI | InChI=1S/C20H20ClN5O2/c1-13-8-15(2-3-17(13)21)28-16-9-18(14-11-23-20(22)24-12-14)25-19(10-16)26-4-6-27-7-5-26/h2-3,8-12H,4-7H2,1H3,(H2,22,23,24) |
| InChIKey | BDYOZMOFSDCZGJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |