C14H16ClN5O2 — CID 74250778
4-(5-chloro-2-methoxy-4-pyridinyl)-6-morpholin-4-ylpyrimidin-2-amine (PubChem CID 74250778) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxy-4-pyridinyl)-6-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 4-(5-chloro-2-methoxy-4-pyridinyl)-6-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 74250778 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-(5-chloro-2-methoxy-4-pyridinyl)-6-morpholin-4-ylpyrimidin-2-amine |
| SMILES | COc1cc(-c2cc(N3CCOCC3)nc(N)n2)c(Cl)cn1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-21-13-6-9(10(15)8-17-13)11-7-12(19-14(16)18-11)20-2-4-22-5-3-20/h6-8H,2-5H2,1H3,(H2,16,18,19) |
| InChIKey | MIRQKOQXMSTOPP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |