C11H14N6O — CID 50982860
4-morpholin-4-yl-6-(1H-pyrazol-5-yl)pyrimidin-2-amine (PubChem CID 50982860) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-(1H-pyrazol-5-yl)pyrimidin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-(1H-pyrazol-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 50982860 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-morpholin-4-yl-6-(1H-pyrazol-5-yl)pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccn[nH]2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H14N6O/c12-11-14-9(8-1-2-13-16-8)7-10(15-11)17-3-5-18-6-4-17/h1-2,7H,3-6H2,(H,13,16)(H2,12,14,15) |
| InChIKey | RZVYSELXDRVOEJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |