C12H15N3O3 — CID 157320415
5-(3-methyl-3H-pyrrol-5-yl)-5-(3-oxobutyl)imidazolidine-2,4-dione (PubChem CID 157320415) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-(3-methyl-3H-pyrrol-5-yl)-5-(3-oxobutyl)imidazolidine-2,4-dione.
| Compound Name | 5-(3-methyl-3H-pyrrol-5-yl)-5-(3-oxobutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 157320415 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 5-(3-methyl-3H-pyrrol-5-yl)-5-(3-oxobutyl)imidazolidine-2,4-dione |
| SMILES | CC(=O)CCC1(C2=CC(C)C=N2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H15N3O3/c1-7-5-9(13-6-7)12(4-3-8(2)16)10(17)14-11(18)15-12/h5-7H,3-4H2,1-2H3,(H2,14,15,17,18) |
| InChIKey | UFXTYOGXGHBBIZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|