About CID 157320578
CID 157320578 (PubChem CID 157320578) has the molecular formula C20H15GaN3O
and a molecular weight of 383.08 g/mol.
Molecular Properties
| Compound Name | CID 157320578 |
| PubChem CID | 157320578 |
| Molecular Formula | C20H15GaN3O |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | — |
| SMILES | O=c1cccc(-c2cn(-c3ccccc3)c(-c3ccccc3)n2)n1[GaH] |
| InChI | InChI=1S/C20H15N3O.Ga.H/c24-19-13-7-12-17(21-19)18-14-23(16-10-5-2-6-11-16)20(22-18)15-8-3-1-4-9-15;;/h1-14H,(H,21,24);;/q;+1;/p-1 |
| InChIKey | PANJCHQKUYGPTF-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 157320578 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157320578?
The IUPAC name of CID 157320578 (CID 157320578) is not available.
What is the SMILES notation for CID 157320578?
The canonical SMILES for CID 157320578 is O=c1cccc(-c2cn(-c3ccccc3)c(-c3ccccc3)n2)n1[GaH].
What is the InChIKey of CID 157320578?
The InChIKey is PANJCHQKUYGPTF-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H15N3O.Ga.H/c24-19-13-7-12-17(21-19)18-14-23(16-10-5-2-6-11-16)20(22-18)15-8-3-1-4-9-15;;/h1-14H,(H,21,24);;/q;+1;/p-1.
What are the key properties of CID 157320578?
CID 157320578 has a molecular weight of 383.08 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157320578 is sourced from PubChem (CID 157320578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).