C21H18N2S — CID 140702649
4-(3,4-dimethylthiophen-2-yl)-1,2-diphenylimidazole (PubChem CID 140702649) has the molecular formula C21H18N2S and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-(3,4-dimethylthiophen-2-yl)-1,2-diphenylimidazole.
| Compound Name | 4-(3,4-dimethylthiophen-2-yl)-1,2-diphenylimidazole |
|---|---|
| PubChem CID | 140702649 |
| Molecular Formula | C21H18N2S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-(3,4-dimethylthiophen-2-yl)-1,2-diphenylimidazole |
| SMILES | Cc1csc(-c2cn(-c3ccccc3)c(-c3ccccc3)n2)c1C |
| InChI | InChI=1S/C21H18N2S/c1-15-14-24-20(16(15)2)19-13-23(18-11-7-4-8-12-18)21(22-19)17-9-5-3-6-10-17/h3-14H,1-2H3 |
| InChIKey | SPPIXJXZFWPQIT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |