C29H32F3NO3S — CID 157327969
N-[3-(3-cyclohexylpropylsulfonyl)phenyl]-4-phenylmethoxy-2-(trifluoromethyl)aniline (PubChem CID 157327969) has the molecular formula C29H32F3NO3S and a molecular weight of 531.64 g/mol. Its IUPAC name is N-[3-(3-cyclohexylpropylsulfonyl)phenyl]-4-phenylmethoxy-2-(trifluoromethyl)aniline.
| Compound Name | N-[3-(3-cyclohexylpropylsulfonyl)phenyl]-4-phenylmethoxy-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 157327969 |
| Molecular Formula | C29H32F3NO3S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-[3-(3-cyclohexylpropylsulfonyl)phenyl]-4-phenylmethoxy-2-(trifluoromethyl)aniline |
| SMILES | O=S(=O)(CCCC1CCCCC1)c1cccc(Nc2ccc(OCc3ccccc3)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C29H32F3NO3S/c30-29(31,32)27-20-25(36-21-23-11-5-2-6-12-23)16-17-28(27)33-24-14-7-15-26(19-24)37(34,35)18-8-13-22-9-3-1-4-10-22/h2,5-7,11-12,14-17,19-20,22,33H,1,3-4,8-10,13,18,21H2 |
| InChIKey | WVIHMNDYIGTWIT-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |