C16H10N2O5S — CID 15733409
5-(4-hydroxyphenyl)-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 15733409) has the molecular formula C16H10N2O5S and a molecular weight of 342.33 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(4-hydroxyphenyl)-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 15733409 |
| Molecular Formula | C16H10N2O5S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 5-(4-hydroxyphenyl)-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C(C1=NOC2C(=O)N(c3ccc(O)cc3)C(=O)C12)c1cccs1 |
| InChI | InChI=1S/C16H10N2O5S/c19-9-5-3-8(4-6-9)18-15(21)11-12(17-23-14(11)16(18)22)13(20)10-2-1-7-24-10/h1-7,11,14,19H |
| InChIKey | XBEGTHXKBKLIEF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|