C16H10N2O4S — CID 51397386
(3aR,6aR)-5-phenyl-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 51397386) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is (3aR,6aR)-5-phenyl-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aR,6aR)-5-phenyl-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 51397386 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (3aR,6aR)-5-phenyl-3-(thiophene-2-carbonyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C(C1=NO[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]12)c1cccs1 |
| InChI | InChI=1S/C16H10N2O4S/c19-13(10-7-4-8-23-10)12-11-14(22-17-12)16(21)18(15(11)20)9-5-2-1-3-6-9/h1-8,11,14H/t11-,14-/m1/s1 |
| InChIKey | JYZNJESGLCRSBP-BXUZGUMPSA-N |
| XLogP | 1.88 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|