C10H17N5 — CID 157340920
1-(2-cyclopenta-1,4-dien-1-ylethyl)-3-(diaminomethylidene)-1-methylguanidine (PubChem CID 157340920) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-(2-cyclopenta-1,4-dien-1-ylethyl)-3-(diaminomethylidene)-1-methylguanidine.
| Compound Name | 1-(2-cyclopenta-1,4-dien-1-ylethyl)-3-(diaminomethylidene)-1-methylguanidine |
|---|---|
| PubChem CID | 157340920 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-(2-cyclopenta-1,4-dien-1-ylethyl)-3-(diaminomethylidene)-1-methylguanidine |
| SMILES | [H]/N=C(/N=C(N)N)N(C)CCC1=CCC=C1 |
| InChI | InChI=1S/C10H17N5/c1-15(10(13)14-9(11)12)7-6-8-4-2-3-5-8/h2,4-5H,3,6-7H2,1H3,(H5,11,12,13,14) |
| InChIKey | LATOUUFTPHEUHR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|