C25H28N2O3S — CID 157347369
1-(2,6-dimethylquinolin-3-yl)-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one (PubChem CID 157347369) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-(2,6-dimethylquinolin-3-yl)-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one.
| Compound Name | 1-(2,6-dimethylquinolin-3-yl)-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 157347369 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-(2,6-dimethylquinolin-3-yl)-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one |
| SMILES | Cc1ccc2nc(C)c(C(=O)CCc3ccc(S(=O)(=O)N4CCCCC4)cc3)cc2c1 |
| InChI | InChI=1S/C25H28N2O3S/c1-18-6-12-24-21(16-18)17-23(19(2)26-24)25(28)13-9-20-7-10-22(11-8-20)31(29,30)27-14-4-3-5-15-27/h6-8,10-12,16-17H,3-5,9,13-15H2,1-2H3 |
| InChIKey | CCLPBIHBTYUKKZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |