C24H26N2O4S — CID 158717893
1-(6-methoxy-2-methylquinolin-3-yl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one (PubChem CID 158717893) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-(6-methoxy-2-methylquinolin-3-yl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one.
| Compound Name | 1-(6-methoxy-2-methylquinolin-3-yl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 158717893 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(6-methoxy-2-methylquinolin-3-yl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one |
| SMILES | COc1ccc2nc(C)c(C(=O)CCc3ccc(S(=O)(=O)N4CCCC4)cc3)cc2c1 |
| InChI | InChI=1S/C24H26N2O4S/c1-17-22(16-19-15-20(30-2)8-11-23(19)25-17)24(27)12-7-18-5-9-21(10-6-18)31(28,29)26-13-3-4-14-26/h5-6,8-11,15-16H,3-4,7,12-14H2,1-2H3 |
| InChIKey | DIOHFGHQMQTCJG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |