C21H25ClN4O9P2 — CID 157353456
[[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 157353456) has the molecular formula C21H25ClN4O9P2 and a molecular weight of 574.85 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 157353456 |
| Molecular Formula | C21H25ClN4O9P2 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | [[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(N[C@H]4CCc5ccccc54)cc(Cl)nc32)[C@@H](O)C1O |
| InChI | InChI=1S/C21H25ClN4O9P2/c22-17-7-15(24-14-6-5-11-3-1-2-4-12(11)14)13-8-23-26(20(13)25-17)21-19(28)18(27)16(35-21)9-34-37(32,33)10-36(29,30)31/h1-4,7-8,14,16,18-19,21,27-28H,5-6,9-10H2,(H,24,25)(H,32,33)(H2,29,30,31)/t14-,16+,18?,19-,21+/m0/s1 |
| InChIKey | BHUNCUBIHSEMFT-QLIUSGSDSA-N |
| XLogP | 2.14 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|