About 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one
1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 157356546) has the molecular formula C40H54N6O2S2
and a molecular weight of 715.05 g/mol. Its IUPAC name is 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one |
| PubChem CID | 157356546 |
| Molecular Formula | C40H54N6O2S2 |
| Molecular Weight | 715.05 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | CC(C)(C)C1CN(c2nccs2)CCN1C(=O)CCc1ccccc1.CC(C)(C)C1CN(c2nccs2)CCN1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/2C20H27N3OS/c2*1-20(2,3)17-15-22(19-21-11-14-25-19)12-13-23(17)18(24)10-9-16-7-5-4-6-8-16/h2*4-8,11,14,17H,9-10,12-13,15H2,1-3H3 |
| InChIKey | BIDOMSCTNNHPMI-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 715.05 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one?
The IUPAC name of 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one (CID 157356546) is 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one.
What is the SMILES notation for 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one?
The canonical SMILES for 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one is CC(C)(C)C1CN(c2nccs2)CCN1C(=O)CCc1ccccc1.CC(C)(C)C1CN(c2nccs2)CCN1C(=O)CCc1ccccc1.
What is the InChIKey of 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one?
The InChIKey is BIDOMSCTNNHPMI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H27N3OS/c2*1-20(2,3)17-15-22(19-21-11-14-25-19)12-13-23(17)18(24)10-9-16-7-5-4-6-8-16/h2*4-8,11,14,17H,9-10,12-13,15H2,1-3H3.
What are the key properties of 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one?
1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one has a molecular weight of 715.05 g/mol, XLogP of 7.68, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-tert-butyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylpropan-1-one is sourced from PubChem (CID 157356546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).