C44H46N6O2S2 — CID 158686167
3-phenyl-1-[2-phenyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-one (PubChem CID 158686167) has the molecular formula C44H46N6O2S2 and a molecular weight of 755.03 g/mol. Its IUPAC name is 3-phenyl-1-[2-phenyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-phenyl-1-[2-phenyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 158686167 |
| Molecular Formula | C44H46N6O2S2 |
| Molecular Weight | 755.03 g/mol |
| Exact Mass | 754.31 |
| IUPAC Name | 3-phenyl-1-[2-phenyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCN(c2nccs2)CC1c1ccccc1.O=C(CCc1ccccc1)N1CCN(c2nccs2)CC1c1ccccc1 |
| InChI | InChI=1S/2C22H23N3OS/c2*26-21(12-11-18-7-3-1-4-8-18)25-15-14-24(22-23-13-16-27-22)17-20(25)19-9-5-2-6-10-19/h2*1-10,13,16,20H,11-12,14-15,17H2 |
| InChIKey | IFTMPUKVIMTADY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.03 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |