C37H43FN2O5 — CID 157358171
methyl 3-(dibenzylamino)-2-fluoropropanoate;methyl 3-(dibenzylamino)-4-hydroxybutanoate (PubChem CID 157358171) has the molecular formula C37H43FN2O5 and a molecular weight of 614.76 g/mol. Its IUPAC name is methyl 3-(dibenzylamino)-2-fluoropropanoate;methyl 3-(dibenzylamino)-4-hydroxybutanoate.
| Compound Name | methyl 3-(dibenzylamino)-2-fluoropropanoate;methyl 3-(dibenzylamino)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 157358171 |
| Molecular Formula | C37H43FN2O5 |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | methyl 3-(dibenzylamino)-2-fluoropropanoate;methyl 3-(dibenzylamino)-4-hydroxybutanoate |
| SMILES | COC(=O)C(F)CN(Cc1ccccc1)Cc1ccccc1.COC(=O)CC(CO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO3.C18H20FNO2/c1-23-19(22)12-18(15-21)20(13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17;1-22-18(21)17(19)14-20(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,18,21H,12-15H2,1H3;2-11,17H,12-14H2,1H3 |
| InChIKey | BIIHAJJKEWCMQE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |