C29H39N3O8 — CID 157359425
2-(2-amino-4-methoxyphenyl)propan-2-ol;5-methoxy-2-propan-2-ylaniline;methyl 4-methoxy-2-nitrobenzoate (PubChem CID 157359425) has the molecular formula C29H39N3O8 and a molecular weight of 557.64 g/mol. Its IUPAC name is 2-(2-amino-4-methoxyphenyl)propan-2-ol;5-methoxy-2-propan-2-ylaniline;methyl 4-methoxy-2-nitrobenzoate.
| Compound Name | 2-(2-amino-4-methoxyphenyl)propan-2-ol;5-methoxy-2-propan-2-ylaniline;methyl 4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 157359425 |
| Molecular Formula | C29H39N3O8 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 2-(2-amino-4-methoxyphenyl)propan-2-ol;5-methoxy-2-propan-2-ylaniline;methyl 4-methoxy-2-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1[N+](=O)[O-].COc1ccc(C(C)(C)O)c(N)c1.COc1ccc(C(C)C)c(N)c1 |
| InChI | InChI=1S/C10H15NO2.C10H15NO.C9H9NO5/c1-10(2,12)8-5-4-7(13-3)6-9(8)11;1-7(2)9-5-4-8(12-3)6-10(9)11;1-14-6-3-4-7(9(11)15-2)8(5-6)10(12)13/h4-6,12H,11H2,1-3H3;4-7H,11H2,1-3H3;3-5H,1-2H3 |
| InChIKey | BILPFGYBSYLYFZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|