2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride

C17H21BrClNO — CID 15736

IUPAC2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride
SMILESC[NH+](C)CCOC(c1ccccc1)c1ccc(Br)cc1.[Cl-]
InChIInChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H
InChIKeyZQDJSWUEGOYDGT-UHFFFAOYSA-N
MW370.72 g/mol
LogP-0.30
Rot. Bonds6

About 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride

2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride (PubChem CID 15736) has the molecular formula C17H21BrClNO and a molecular weight of 370.72 g/mol. Its IUPAC name is 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride.

Molecular Properties

Compound Name2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride
PubChem CID15736
Molecular FormulaC17H21BrClNO
Molecular Weight370.72 g/mol
Exact Mass369.05
IUPAC Name2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride
SMILESC[NH+](C)CCOC(c1ccccc1)c1ccc(Br)cc1.[Cl-]
InChIInChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H
InChIKeyZQDJSWUEGOYDGT-UHFFFAOYSA-N
XLogP-0.30
TPSA13.67 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.72
LogP ≤ 5-0.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride?
The IUPAC name of 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride (CID 15736) is 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride.
What is the SMILES notation for 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride?
The canonical SMILES for 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride is C[NH+](C)CCOC(c1ccccc1)c1ccc(Br)cc1.[Cl-].
What is the InChIKey of 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride?
The InChIKey is ZQDJSWUEGOYDGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H.
What are the key properties of 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride?
2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride has a molecular weight of 370.72 g/mol, XLogP of -0.30, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromophenyl)-phenylmethoxy]ethyl-dimethylazanium chloride is sourced from PubChem (CID 15736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).