C21H20N2O4 — CID 15736045
N-[(E,2S)-4-cyano-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-1-phenylpent-4-en-2-yl]acetamide (PubChem CID 15736045) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[(E,2S)-4-cyano-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-1-phenylpent-4-en-2-yl]acetamide.
| Compound Name | N-[(E,2S)-4-cyano-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-1-phenylpent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 15736045 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[(E,2S)-4-cyano-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-1-phenylpent-4-en-2-yl]acetamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)[C@H](Cc2ccccc2)NC(C)=O)ccc1O |
| InChI | InChI=1S/C21H20N2O4/c1-14(24)23-18(11-15-6-4-3-5-7-15)21(26)17(13-22)10-16-8-9-19(25)20(12-16)27-2/h3-10,12,18,25H,11H2,1-2H3,(H,23,24)/b17-10+/t18-/m0/s1 |
| InChIKey | KVDBURMBOJXQLK-LTXFRBGYSA-N |
| XLogP | 2.62 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|