C10H10F12O4 — CID 157360996
bis(2,2,3,3-tetrafluoropropyl) carbonate;2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 157360996) has the molecular formula C10H10F12O4 and a molecular weight of 422.16 g/mol. Its IUPAC name is bis(2,2,3,3-tetrafluoropropyl) carbonate;2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | bis(2,2,3,3-tetrafluoropropyl) carbonate;2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 157360996 |
| Molecular Formula | C10H10F12O4 |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | bis(2,2,3,3-tetrafluoropropyl) carbonate;2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | O=C(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F.OCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H6F8O3.C3H4F4O/c8-3(9)6(12,13)1-17-5(16)18-2-7(14,15)4(10)11;4-2(5)3(6,7)1-8/h3-4H,1-2H2;2,8H,1H2 |
| InChIKey | BIQFGPMGGYVFED-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|