C13H10F18O4 — CID 159947323
bis(2,2,3,4,4,4-hexafluorobutyl) carbonate;2,2,3,4,4,4-hexafluorobutan-1-ol (PubChem CID 159947323) has the molecular formula C13H10F18O4 and a molecular weight of 572.18 g/mol. Its IUPAC name is bis(2,2,3,4,4,4-hexafluorobutyl) carbonate;2,2,3,4,4,4-hexafluorobutan-1-ol.
| Compound Name | bis(2,2,3,4,4,4-hexafluorobutyl) carbonate;2,2,3,4,4,4-hexafluorobutan-1-ol |
|---|---|
| PubChem CID | 159947323 |
| Molecular Formula | C13H10F18O4 |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | bis(2,2,3,4,4,4-hexafluorobutyl) carbonate;2,2,3,4,4,4-hexafluorobutan-1-ol |
| SMILES | O=C(OCC(F)(F)C(F)C(F)(F)F)OCC(F)(F)C(F)C(F)(F)F.OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F12O3.C4H4F6O/c10-3(8(16,17)18)6(12,13)1-23-5(22)24-2-7(14,15)4(11)9(19,20)21;5-2(4(8,9)10)3(6,7)1-11/h3-4H,1-2H2;2,11H,1H2 |
| InChIKey | OBQQTKALZPNZKA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |