C13H7F21O4 — CID 159940703
bis(2,2,3,3,4,4,4-heptafluorobutyl) carbonate;2,2,3,3,4,4,4-heptafluorobutan-1-ol (PubChem CID 159940703) has the molecular formula C13H7F21O4 and a molecular weight of 626.15 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,4-heptafluorobutyl) carbonate;2,2,3,3,4,4,4-heptafluorobutan-1-ol.
| Compound Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) carbonate;2,2,3,3,4,4,4-heptafluorobutan-1-ol |
|---|---|
| PubChem CID | 159940703 |
| Molecular Formula | C13H7F21O4 |
| Molecular Weight | 626.15 g/mol |
| Exact Mass | 626.00 |
| IUPAC Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) carbonate;2,2,3,3,4,4,4-heptafluorobutan-1-ol |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)F)OCC(F)(F)C(F)(F)C(F)(F)F.OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F14O3.C4H3F7O/c10-4(11,6(14,15)8(18,19)20)1-25-3(24)26-2-5(12,13)7(16,17)9(21,22)23;5-2(6,1-12)3(7,8)4(9,10)11/h1-2H2;12H,1H2 |
| InChIKey | OAVKNPDEKSWVHF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.15 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|