C32H51N3O3 — CID 157364500
(2S)-N-[(5S)-1-amino-8-methyl-6-oxononan-5-yl]-1-[(E,2S,5S)-2-benzyl-5,7-dimethyloct-3-enoyl]pyrrolidine-2-carboxamide (PubChem CID 157364500) has the molecular formula C32H51N3O3 and a molecular weight of 525.78 g/mol. Its IUPAC name is (2S)-N-[(5S)-1-amino-8-methyl-6-oxononan-5-yl]-1-[(E,2S,5S)-2-benzyl-5,7-dimethyloct-3-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(5S)-1-amino-8-methyl-6-oxononan-5-yl]-1-[(E,2S,5S)-2-benzyl-5,7-dimethyloct-3-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 157364500 |
| Molecular Formula | C32H51N3O3 |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 525.39 |
| IUPAC Name | (2S)-N-[(5S)-1-amino-8-methyl-6-oxononan-5-yl]-1-[(E,2S,5S)-2-benzyl-5,7-dimethyloct-3-enoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)CC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@H](/C=C/[C@@H](C)CC(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C32H51N3O3/c1-23(2)20-25(5)16-17-27(22-26-12-7-6-8-13-26)32(38)35-19-11-15-29(35)31(37)34-28(14-9-10-18-33)30(36)21-24(3)4/h6-8,12-13,16-17,23-25,27-29H,9-11,14-15,18-22,33H2,1-5H3,(H,34,37)/b17-16+/t25-,27-,28+,29+/m1/s1 |
| InChIKey | HQULPEBXUIETBB-KMKCYSLDSA-N |
| XLogP | 5.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|