C23H26N2O3 — CID 157366571
9H-fluoren-9-ylmethyl N-[3-oxo-5-(prop-1-en-2-ylamino)pentan-2-yl]carbamate (PubChem CID 157366571) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-oxo-5-(prop-1-en-2-ylamino)pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-oxo-5-(prop-1-en-2-ylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 157366571 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-oxo-5-(prop-1-en-2-ylamino)pentan-2-yl]carbamate |
| SMILES | C=C(C)NCCC(=O)C(C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26N2O3/c1-15(2)24-13-12-22(26)16(3)25-23(27)28-14-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,16,21,24H,1,12-14H2,2-3H3,(H,25,27) |
| InChIKey | BJGFEVFZFDFURC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |