C28H27NO5 — CID 70911230
[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxobutyl] 2,6-dimethylbenzoate (PubChem CID 70911230) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is [(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxobutyl] 2,6-dimethylbenzoate.
| Compound Name | [(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxobutyl] 2,6-dimethylbenzoate |
|---|---|
| PubChem CID | 70911230 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxobutyl] 2,6-dimethylbenzoate |
| SMILES | Cc1cccc(C)c1C(=O)OCC(=O)[C@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H27NO5/c1-17-9-8-10-18(2)26(17)27(31)33-16-25(30)19(3)29-28(32)34-15-24-22-13-6-4-11-20(22)21-12-5-7-14-23(21)24/h4-14,19,24H,15-16H2,1-3H3,(H,29,32)/t19-/m0/s1 |
| InChIKey | DASWUJRAHGPXOJ-IBGZPJMESA-N |
| XLogP | 4.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |