C40H48N2O8 — CID 157366588
bis(1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethanone);1,10-phenanthroline (PubChem CID 157366588) has the molecular formula C40H48N2O8 and a molecular weight of 684.83 g/mol. Its IUPAC name is bis(1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethanone);1,10-phenanthroline.
| Compound Name | bis(1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethanone);1,10-phenanthroline |
|---|---|
| PubChem CID | 157366588 |
| Molecular Formula | C40H48N2O8 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.34 |
| IUPAC Name | bis(1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethanone);1,10-phenanthroline |
| SMILES | CCOCCOCCOc1ccc(C(C)=O)cc1.CCOCCOCCOc1ccc(C(C)=O)cc1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/2C14H20O4.C12H8N2/c2*1-3-16-8-9-17-10-11-18-14-6-4-13(5-7-14)12(2)15;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h2*4-7H,3,8-11H2,1-2H3;1-8H |
| InChIKey | BJGGRPQZKCXQFD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|