C22H19BrN2O2 — CID 21204392
1-(4-methoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)propan-1-one bromide (PubChem CID 21204392) has the molecular formula C22H19BrN2O2 and a molecular weight of 423.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)propan-1-one bromide.
| Compound Name | 1-(4-methoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)propan-1-one bromide |
|---|---|
| PubChem CID | 21204392 |
| Molecular Formula | C22H19BrN2O2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)propan-1-one bromide |
| SMILES | COc1ccc(C(=O)C(C)[n+]2cccc3ccc4cccnc4c32)cc1.[Br-] |
| InChI | InChI=1S/C22H19N2O2.BrH/c1-15(22(25)18-9-11-19(26-2)12-10-18)24-14-4-6-17-8-7-16-5-3-13-23-20(16)21(17)24;/h3-15H,1-2H3;1H/q+1;/p-1 |
| InChIKey | NTEVGKXHEOMCMI-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|