C16H7ClFNO2S — CID 15737171
13-chloro-16-fluoro-5,7-dioxa-11-thia-14-azapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene (PubChem CID 15737171) has the molecular formula C16H7ClFNO2S and a molecular weight of 331.76 g/mol. Its IUPAC name is 13-chloro-16-fluoro-5,7-dioxa-11-thia-14-azapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene.
| Compound Name | 13-chloro-16-fluoro-5,7-dioxa-11-thia-14-azapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene |
|---|---|
| PubChem CID | 15737171 |
| Molecular Formula | C16H7ClFNO2S |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 13-chloro-16-fluoro-5,7-dioxa-11-thia-14-azapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene |
| SMILES | Fc1cccc2c1nc(Cl)c1sc3cc4c(cc3c12)OCO4 |
| InChI | InChI=1S/C16H7ClFNO2S/c17-16-15-13(7-2-1-3-9(18)14(7)19-16)8-4-10-11(21-6-20-10)5-12(8)22-15/h1-5H,6H2 |
| InChIKey | IQZUMGLDOQXHLT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|