C17H11FNO2S+ — CID 15737183
16-fluoro-14-methyl-5,7-dioxa-11-thia-14-azoniapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene (PubChem CID 15737183) has the molecular formula C17H11FNO2S+ and a molecular weight of 312.35 g/mol. Its IUPAC name is 16-fluoro-14-methyl-5,7-dioxa-11-thia-14-azoniapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene.
| Compound Name | 16-fluoro-14-methyl-5,7-dioxa-11-thia-14-azoniapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene |
|---|---|
| PubChem CID | 15737183 |
| Molecular Formula | C17H11FNO2S+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 16-fluoro-14-methyl-5,7-dioxa-11-thia-14-azoniapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(20),2,4(8),9,12,14,16,18-octaene |
| SMILES | C[n+]1cc2sc3cc4c(cc3c2c2cccc(F)c21)OCO4 |
| InChI | InChI=1S/C17H11FNO2S/c1-19-7-15-16(9-3-2-4-11(18)17(9)19)10-5-12-13(21-8-20-12)6-14(10)22-15/h2-7H,8H2,1H3/q+1 |
| InChIKey | LTLHDTGOFIRNKA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|