C11H13FN4O5P+ — CID 157372712
[(2R,3S,4R,5R)-5-ethyl-4-fluoro-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 157372712) has the molecular formula C11H13FN4O5P+ and a molecular weight of 331.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-ethyl-4-fluoro-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-ethyl-4-fluoro-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 157372712 |
| Molecular Formula | C11H13FN4O5P+ |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-ethyl-4-fluoro-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](O[P+](=O)O)[C@@H]1F |
| InChI | InChI=1S/C11H12FN4O5P/c1-2-5-6(12)8(21-22(18)19)11(20-5)16-4-15-7-9(16)13-3-14-10(7)17/h3-6,8,11H,2H2,1H3,(H-,13,14,17,18,19)/p+1/t5-,6-,8-,11-/m1/s1 |
| InChIKey | PYRBFKWAJWILCH-HUKYDQBMSA-O |
| XLogP | 0.80 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|