C38H47ClN6O4 — CID 157372810
1-benzylpiperazine;methyl 2-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]acetate;methyl 2-(6-chloro-3-pyridinyl)acetate (PubChem CID 157372810) has the molecular formula C38H47ClN6O4 and a molecular weight of 687.29 g/mol. Its IUPAC name is 1-benzylpiperazine;methyl 2-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]acetate;methyl 2-(6-chloro-3-pyridinyl)acetate.
| Compound Name | 1-benzylpiperazine;methyl 2-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]acetate;methyl 2-(6-chloro-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 157372810 |
| Molecular Formula | C38H47ClN6O4 |
| Molecular Weight | 687.29 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 1-benzylpiperazine;methyl 2-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]acetate;methyl 2-(6-chloro-3-pyridinyl)acetate |
| SMILES | COC(=O)Cc1ccc(Cl)nc1.COC(=O)Cc1ccc(N2CCN(Cc3ccccc3)CC2)nc1.c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C19H23N3O2.C11H16N2.C8H8ClNO2/c1-24-19(23)13-17-7-8-18(20-14-17)22-11-9-21(10-12-22)15-16-5-3-2-4-6-16;1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;1-12-8(11)4-6-2-3-7(9)10-5-6/h2-8,14H,9-13,15H2,1H3;1-5,12H,6-10H2;2-3,5H,4H2,1H3 |
| InChIKey | BJYSKQRPLRSZQB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|