About 8-chlorofluoranthene
8-chlorofluoranthene (PubChem CID 15737453) has the molecular formula C16H9Cl
and a molecular weight of 236.70 g/mol. Its IUPAC name is 8-chlorofluoranthene.
Molecular Properties
| Compound Name | 8-chlorofluoranthene |
| PubChem CID | 15737453 |
| Molecular Formula | C16H9Cl |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 8-chlorofluoranthene |
| SMILES | Clc1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H9Cl/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H |
| InChIKey | IVGPRQSZXKDUPG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8-chlorofluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorofluoranthene?
The IUPAC name of 8-chlorofluoranthene (CID 15737453) is 8-chlorofluoranthene.
What is the SMILES notation for 8-chlorofluoranthene?
The canonical SMILES for 8-chlorofluoranthene is Clc1ccc2c(c1)-c1cccc3cccc-2c13.
What is the InChIKey of 8-chlorofluoranthene?
The InChIKey is IVGPRQSZXKDUPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H.
What are the key properties of 8-chlorofluoranthene?
8-chlorofluoranthene has a molecular weight of 236.70 g/mol, XLogP of 5.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorofluoranthene is sourced from PubChem (CID 15737453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).