C19H13Cl — CID 167442671
5-chloro-8-methyltetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,5,8,10,12,14(18),15-nonaene (PubChem CID 167442671) has the molecular formula C19H13Cl and a molecular weight of 276.77 g/mol. Its IUPAC name is 5-chloro-8-methyltetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,5,8,10,12,14(18),15-nonaene.
| Compound Name | 5-chloro-8-methyltetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,5,8,10,12,14(18),15-nonaene |
|---|---|
| PubChem CID | 167442671 |
| Molecular Formula | C19H13Cl |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-chloro-8-methyltetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,5,8,10,12,14(18),15-nonaene |
| SMILES | CC1=Cc2cccc3cccc(c23)-c2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H13Cl/c1-12-10-14-6-2-4-13-5-3-7-17(19(13)14)16-9-8-15(20)11-18(12)16/h2-11H,1H3 |
| InChIKey | REZHVMBSBSRRLN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|