C20H24BrNO3 — CID 157377133
4-(5-bromo-1-methylindol-3-yl)-1-(2-methyloxiran-2-yl)-2-(2-methylpropyl)butane-1,4-dione (PubChem CID 157377133) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 4-(5-bromo-1-methylindol-3-yl)-1-(2-methyloxiran-2-yl)-2-(2-methylpropyl)butane-1,4-dione.
| Compound Name | 4-(5-bromo-1-methylindol-3-yl)-1-(2-methyloxiran-2-yl)-2-(2-methylpropyl)butane-1,4-dione |
|---|---|
| PubChem CID | 157377133 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-(5-bromo-1-methylindol-3-yl)-1-(2-methyloxiran-2-yl)-2-(2-methylpropyl)butane-1,4-dione |
| SMILES | CC(C)CC(CC(=O)c1cn(C)c2ccc(Br)cc12)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C20H24BrNO3/c1-12(2)7-13(19(24)20(3)11-25-20)8-18(23)16-10-22(4)17-6-5-14(21)9-15(16)17/h5-6,9-10,12-13H,7-8,11H2,1-4H3 |
| InChIKey | RXOLLBDFEOHIIC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|